- 4'-Chloropropiophenone
-
- $10.00 / 1ASSAYS
-
2025-03-29
- CAS:6285-05-8
- Min. Order: 1ASSAYS
- Purity: 99%
- Supply Ability: 10 ton
|
| | 4'-Chloropropiophenone Basic information |
| | 4'-Chloropropiophenone Chemical Properties |
| Melting point | 35-37 °C(lit.) | | Boiling point | 95-97 °C1 mm Hg(lit.) | | density | 1.151 | | refractive index | 1.5325-1.5345 | | Fp | >230 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | powder to crystal | | color | White to Almost white | | Water Solubility | Insoluble | | BRN | 1100638 | | InChI | InChI=1S/C9H9ClO/c1-2-9(11)7-3-5-8(10)6-4-7/h3-6H,2H2,1H3 | | InChIKey | ADCYRBXQAJXJTD-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(Cl)C=C1)(=O)CC | | LogP | 2.4 | | CAS DataBase Reference | 6285-05-8(CAS DataBase Reference) | | NIST Chemistry Reference | 1-Propanone, 1-(4-chlorophenyl)-(6285-05-8) | | EPA Substance Registry System | 1-Propanone, 1-(4-chlorophenyl)- (6285-05-8) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26-24/25 | | WGK Germany | 3 | | RTECS | UG9275000 | | TSCA | Yes | | PackingGroup | II | | HS Code | 29147000 |
| | 4'-Chloropropiophenone Usage And Synthesis |
| Chemical Properties | CRYSTALLINE MASS | | Chemical Properties | 4-Chlorophenylacetone is a common ketone compound. 4-Chlorophenylacetone appears as gray white block crystals. | | Uses | 4-Chlorophenylacetone is a chemical raw material and pharmaceutical intermediate with important application value. It has very important applications in modern pharmaceutical, chemical and biological fields. | | Safety Profile | Poison by
intraperitoneal and intravenous routes.
When heated to decomposition it emits
toxic fumes of Cl-. |
| | 4'-Chloropropiophenone Preparation Products And Raw materials |
|