|
|
| | FMOC-SER(TBU)-SER(PSIME,MEPRO)-OH Basic information |
| Product Name: | FMOC-SER(TBU)-SER(PSIME,MEPRO)-OH | | Synonyms: | FMOC-SER(TBU)-SER(PSIME,MEPRO)-OH;(4S)-3-(FMoc-Ser(tBu))-2,2-diMethyl-oxazolidine-4-carboxylic acid;Fmoc-Ser(OtBu)-Ser{psi(Me,Me)pro}-OH;Fmoc-L-Ser(tBu)-L-Ser[PSI(Me,Me)Pro]-OH;(4S)-3-[(2S)-3-(1,1-Dimethylethoxy)-2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-1-oxopropyl]-2,2-dimethyl-4-oxazolidinecarboxylic acid;(S)-3-[Nα-(9-Fluorenylmethyloxycarbonyl)-O-tert-butyl-L-serinyl]-2,2-dimethyloxazolidine-4-carboxylic acid;Fmoc-Ser(tBu)-Ser[Psi(Me,Me)Pro]-OH≥ 98.5% (HPLC);Fmoc-Ser(tBu)-Ser[Ψ(Me,Me)Pro]-OH | | CAS: | 1000164-43-1 | | MF: | C28H34N2O7 | | MW: | 510.58 | | EINECS: | | | Product Categories: | peptide | | Mol File: | 1000164-43-1.mol |  |
| | FMOC-SER(TBU)-SER(PSIME,MEPRO)-OH Chemical Properties |
| Boiling point | 716.2±60.0 °C(Predicted) | | density | 1.240±0.06 g/cm3(Predicted) | | storage temp. | Store at +2°C to +8°C. | | pka | 3.03±0.40(Predicted) | | form | powder | | color | White to off-white | | InChIKey | OXEDICXRSSILSN-GOTSBHOMSA-N | | SMILES | O1C[C@@H](C(O)=O)N(C(=O)[C@@H](NC(OCC2C3=C(C=CC=C3)C3=C2C=CC=C3)=O)COC(C)(C)C)C1(C)C |
| | FMOC-SER(TBU)-SER(PSIME,MEPRO)-OH Usage And Synthesis |
| Description | Fmoc-Ser(Tbu)-Ser(Psime,Mepro)-OH is mainly used in the synthesis of peptides, including GLP-1(1-37) polypeptide, Tirzepatide and acylated peptides. | | Chemical Properties | White to off-white powder | | Uses | Fmoc-Ser(tBu)-Ser(PSiMe,MePro)-OH is used as a reactant in the synthesis of peptides and proteins. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-SER(TBU)-SER(PSIME,MEPRO)-OH Preparation Products And Raw materials |
|