- Arctigenin
-
- $0.00 / 1kg
-
2025-04-02
- CAS:7770-78-7
- Min. Order: 1kg
- Purity: 10% 20% 30% 95% 98%
- Supply Ability: 1000 kg
- Arctigenin
-
- $0.00 / 25kg
-
2025-04-02
- CAS:7770-78-7
- Min. Order: 1kg
- Purity: 98%HPLC
- Supply Ability: 1 ton
- (-)-Arctigenin
-
- $0.00 / 1KG
-
2025-04-02
- CAS:7770-78-7
- Min. Order: 1KG
- Purity: 98% HPLC
- Supply Ability: 1000KG
|
| | (-)-Arctigenin Basic information |
| Product Name: | (-)-Arctigenin | | Synonyms: | (3R,4R)-4-[(3,4-DIMETHOXYPHENYL)METHYL]DIHYDRO-3-[(4-HYDROXY-3-METHOXYPHENYL)METHYL]-2(3H)-FURANONE;2(3H)-FURANONE,4-[(3,4-DIMETHOXYPHENYL)METHYL]DIHYDRO-3-[(4-HYDROXY-3-METHOXYPHENYL)METHYL]-,(3R,4R);2(3H)-FURANONE,4-[(3,4-DIMETHOXYPHENYL)METHYL]DIHYDRO-3-[(4-HYDROXY-3-METHOXYPHENYL)METHYL];ARCTIGENIN:2(3H)-FURANONE,4-[(3,4-DIMETHOXYPHENYL)METHYL]DIHYDRO-3-[(4-HYDROXY-3-METHOXYPHENYL)METHYL]-,(3R,4R);2(3H)-Furanone,4-[(3,4-dimethoxyphenyl) methyl];dihydro-3-[(4-hydroxy-3-methoxyphenyl)methyl]-,(3R,4R)-;ARCTIGENIN;ARCTIGENIN(P) | | CAS: | 7770-78-7 | | MF: | C21H24O6 | | MW: | 372.41 | | EINECS: | | | Product Categories: | chemical reagent;pharmaceutical intermediate;phytochemical;reference standards from Chinese medicinal herbs (TCM).;standardized herbal extract;Inhibitors;Miscellaneous Natural Products;Protein Kinase | | Mol File: | 7770-78-7.mol |  |
| | (-)-Arctigenin Chemical Properties |
| Melting point | 98.0 to 102.0 °C | | Boiling point | 567.0±45.0 °C(Predicted) | | density | 1.227±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | solubility | DMSO: 34 mg/mL with heating and sonicating, soluble | | form | solid | | pka | 10.03±0.20(Predicted) | | color | White to Light yellow | | λmax | 280nm(EtOH)(lit.) | | InChI | InChI=1S/C21H24O6/c1-24-18-7-5-13(11-20(18)26-3)8-15-12-27-21(23)16(15)9-14-4-6-17(22)19(10-14)25-2/h4-7,10-11,15-16,22H,8-9,12H2,1-3H3/t15-,16+/m0/s1 | | InChIKey | NQWVSMVXKMHKTF-JKSUJKDBSA-N | | SMILES | O1C[C@H](CC2=CC=C(OC)C(OC)=C2)[C@@H](CC2=CC=C(O)C(OC)=C2)C1=O | | LogP | 2.470 (est) | | CAS DataBase Reference | 7770-78-7(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | RTECS | LY9247000 | | HS Code | 2932.20.4500 |
| | (-)-Arctigenin Usage And Synthesis |
| Uses | Arctigenin is a plant ligan associated with anticancer and antioxidant properties. | | Definition | ChEBI: (-)-Arctigenin is a lignan. | | Biological Activity | Antioxidant, anti-inflammatory, antiproliferative and antiviral agent. Inhibits LPS-induced iNOS expression via inhibition of I κ B α phosphorylation and p65 nuclear translocation (IC 50 = 10 nM). Inhibits HIV-1 replication in vitro . Also potently inhibits MKK1 (IC 50 = 0.5 nM) and provides neuroprotection by binding to kainate receptors. | | storage | -20°C (desiccate) |
| | (-)-Arctigenin Preparation Products And Raw materials |
|