|
|
| | 7S-Cefdinir Basic information |
| Product Name: | 7S-Cefdinir | | Synonyms: | 7S-Cefdinir;(6R,7S)-7-[[(2Z)-2-(2-amino-4-thiazolyl)-2-(hydroxyimino)acetyl]amino]-3-ethenyl-8- oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic Acid;Cefdinir 7-Epimer;7β-[(Z)-2-(2-amino-4-thiazolyl)-2-hydroxyiminoacetamido]-3-vinyl-3-cephem-4-carboxylic acid;Cefdinir impurity 11/Cefdinir CP Impurity N/Cefdinir 7-Epimer/(6R,7S)-7-[[(2Z)-2-(2-amino-4-thiazolyl)-2-(hydroxyimino)acetyl]amino]-3-ethenyl-8- oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic Acid;Cefdinir Impurity 4 (Cefdinir CP Impurity N);7(S)-Cefdinir
DISCONTINUED;Cefdinir Impurity O（Cefdinir CP Impurity N） | | CAS: | 178601-89-3 | | MF: | C14H13N5O5S2 | | MW: | 395.41 | | EINECS: | | | Product Categories: | Chiral Reagents, Pharmaceuticals, Intermediates & Fine Chemicals, Sulfur & Selenium Compounds | | Mol File: | 178601-89-3.mol |  |
| | 7S-Cefdinir Chemical Properties |
| density | 1.89±0.1 g/cm3(Predicted) | | pka | 2.82±0.50(Predicted) | | InChIKey | RTXOFQZKPXMALH-JQISMDCNSA-N | | SMILES | N12[C@@]([H])([C@@H](NC(/C(/C3=CSC(N)=N3)=N\O)=O)C1=O)SCC(C=C)=C2C(O)=O |
| | 7S-Cefdinir Usage And Synthesis |
| Uses | 7S-Cefdinir, is an isomer of Cefdinir (C242670), a Cephalosporin antibiotic structurally similar to Cefixime. It can be used to treat infections caused by several Gram-negative and Gram-positive bacteria. |
| | 7S-Cefdinir Preparation Products And Raw materials |
|